CAS 119483-46-4 is the registry number for H-Allo-Ile-OtBu.HCl, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 119483-46-4) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: IFRYMHOZFAPYPJ-WSZWBAFRSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)