Products 119506-11-5
CAS 119506-11-5 is the registry number for tert-Butyl (S)-2-amino-4,4-dimethylpentanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-amino-4,4-dimethylpentanoate;hydrochloride (CAS 119506-11-5) is a chemical compound with the molecular formula C11H24ClNO2 and a molecular weight of 237.77 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4,4-dimethylpentanoate;hydrochloride. InChIKey: RSWZLXZNITVNCW-QRPNPIFTSA-N.
| Molecular formula | C11H24ClNO2 |
|---|---|
| Molecular weight | 237.77 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4,4-dimethylpentanoate;hydrochloride |
| InChIKey | RSWZLXZNITVNCW-QRPNPIFTSA-N |
| SMILES | CC(C)(C)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)