Products 1582273-18-4

CAS 1582273-18-4 is the registry number for 3-(Pentyl(propan-2-yl)amino)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[pentyl(propan-2-yl)amino]propanoic acid;hydrochloride (CAS 1582273-18-4) is a chemical compound with the molecular formula C11H24ClNO2 and a molecular weight of 237.77 g/mol. IUPAC name: 3-[pentyl(propan-2-yl)amino]propanoic acid;hydrochloride. InChIKey: PWFOSXNLUOVMTI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24ClNO2
Molecular weight237.77 g/mol
IUPAC name3-[pentyl(propan-2-yl)amino]propanoic acid;hydrochloride
InChIKeyPWFOSXNLUOVMTI-UHFFFAOYSA-N
SMILESCCCCCN(CCC(=O)O)C(C)C.Cl

Computed by PubChem (NCBI)