CAS 1239692-16-0 is the registry number for Pregabalin Isopropyl Ester Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CAS 1239692-16-0) is a chemical compound with the molecular formula C11H24ClNO2 and a molecular weight of 237.77 g/mol. IUPAC name: propan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride. InChIKey: PAJYXEKKCOKKCE-PPHPATTJSA-N.
| Molecular formula | C11H24ClNO2 |
|---|---|
| Molecular weight | 237.77 g/mol |
| IUPAC name | propan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| InChIKey | PAJYXEKKCOKKCE-PPHPATTJSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)OC(C)C)CN.Cl |
Computed by PubChem (NCBI)