Products 2138066-00-7

CAS 2138066-00-7 is the registry number for tert-Butyl 7-aminoheptanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 7-aminoheptanoate;hydrochloride (CAS 2138066-00-7) is a chemical compound with the molecular formula C11H24ClNO2 and a molecular weight of 237.77 g/mol. IUPAC name: tert-butyl 7-aminoheptanoate;hydrochloride. InChIKey: NPIWXXXAHSSCJV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24ClNO2
Molecular weight237.77 g/mol
IUPAC nametert-butyl 7-aminoheptanoate;hydrochloride
InChIKeyNPIWXXXAHSSCJV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CCCCCCN.Cl

Computed by PubChem (NCBI)