Products 1195256-01-9
CAS 1195256-01-9 appears in our catalog under these names: 1-[(Benzyloxy)carbonyl]azepane-4-carboxylic acid, 95%, 1-((Benzyloxy)carbonyl)azepane-4-carboxylic acid, 97%, 1-[(benzyloxy)carbonyl]azepane-4-carboxylic acid, 97%, 97%, 1-[(BENZYLOXY)CARBONYL]AZEPANE-4-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 500mg.
1-phenylmethoxycarbonylazepane-4-carboxylic acid (CAS 1195256-01-9) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-phenylmethoxycarbonylazepane-4-carboxylic acid. InChIKey: JLWCNEUUHMLQAZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 1-phenylmethoxycarbonylazepane-4-carboxylic acid |
| InChIKey | JLWCNEUUHMLQAZ-UHFFFAOYSA-N |
| SMILES | C1CC(CCN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)