CAS 1195264-69-7 appears in our catalog under these names: (1H-Indazol-3-yl)methanamine dihydrochloride, 95%, (1H–Indazol–3–yl)methanamine dihydrochloride, (1H-Indazol-3-yl)methanamine dihydrochloride, (1H-Indazol-3-yl)methanamine dihydrochloride, 98%, 98%, 1-(2H-indazol-3-yl)methanamine dihydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 5g.
2H-indazol-3-ylmethanamine;dihydrochloride (CAS 1195264-69-7) is a chemical compound with the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. IUPAC name: 2H-indazol-3-ylmethanamine;dihydrochloride. InChIKey: GPPXPVXRILDDMG-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | 2H-indazol-3-ylmethanamine;dihydrochloride |
| InChIKey | GPPXPVXRILDDMG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)