CAS 61457-01-0 is the registry number for 4,6-Dichloro-2-isobutylpyrimidin-5-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-(2-methylpropyl)pyrimidin-5-amine (CAS 61457-01-0) is a chemical compound with the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. IUPAC name: 4,6-dichloro-2-(2-methylpropyl)pyrimidin-5-amine. InChIKey: YDSPQGBGQKNQKM-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | 4,6-dichloro-2-(2-methylpropyl)pyrimidin-5-amine |
| InChIKey | YDSPQGBGQKNQKM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NC(=C(C(=N1)Cl)N)Cl |
Computed by PubChem (NCBI)