CAS 1630907-20-8 appears in our catalog under these names: (1H-Indazol-4-yl)methanamine dihydrochloride, 95%, (1H-Indazol-4-yl)methanamine dihydrochloride, 97%, (1H-Indazol-4-yl)methanamine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
1H-indazol-4-ylmethanamine;dihydrochloride (CAS 1630907-20-8) is a chemical compound with the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. IUPAC name: 1H-indazol-4-ylmethanamine;dihydrochloride. InChIKey: PNEKQUSIGWEJQP-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | 1H-indazol-4-ylmethanamine;dihydrochloride |
| InChIKey | PNEKQUSIGWEJQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NNC2=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)