CAS 2105838-77-3 appears in our catalog under these names: (Pyrazolo[1,5-a]pyridin-6-ylmethyl)amine dihydrochloride, 95%, (pyrazolo[1,5-a]pyridin-6-ylmethyl)amine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
Pyrazolo[1,5-a]pyridin-6-ylmethanamine;dihydrochloride (CAS 2105838-77-3) is a chemical compound with the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. IUPAC name: pyrazolo[1,5-a]pyridin-6-ylmethanamine;dihydrochloride. InChIKey: VKAWCOQNXDLHPB-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyridin-6-ylmethanamine;dihydrochloride |
| InChIKey | VKAWCOQNXDLHPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN2C1=CC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)