CAS 1195596-70-3 is the registry number for Pyrido[2,3-h]quinazolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1H-pyrido[2,3-h]quinazolin-2-one (CAS 1195596-70-3) is a chemical compound with the molecular formula C11H7N3O and a molecular weight of 197.19 g/mol. IUPAC name: 1H-pyrido[2,3-h]quinazolin-2-one. InChIKey: QZGXKHLZLRKTOV-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1H-pyrido[2,3-h]quinazolin-2-one |
| InChIKey | QZGXKHLZLRKTOV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2NC(=O)N=C3)N=C1 |
Computed by PubChem (NCBI)