Products 76577-78-1
CAS 76577-78-1 is the registry number for 4H-Benzo[b]imidazo[1,2-d][1,4]oxazine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile (CAS 76577-78-1) is a chemical compound with the molecular formula C11H7N3O and a molecular weight of 197.19 g/mol. IUPAC name: 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile. InChIKey: OPDPWJMNJNISNU-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile |
| InChIKey | OPDPWJMNJNISNU-UHFFFAOYSA-N |
| SMILES | C1C2=NC(=CN2C3=CC=CC=C3O1)C#N |
Computed by PubChem (NCBI)