CAS 353259-03-7 appears in our catalog under these names: 4-(Pyrimidin-2-yloxy)benzonitrile, 97%, 4-(Pyrimidin-2-yloxy)benzonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g.
4-pyrimidin-2-yloxybenzonitrile (CAS 353259-03-7) is a chemical compound with the molecular formula C11H7N3O and a molecular weight of 197.19 g/mol. IUPAC name: 4-pyrimidin-2-yloxybenzonitrile. InChIKey: GJOHLRSDLHLMOW-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 4-pyrimidin-2-yloxybenzonitrile |
| InChIKey | GJOHLRSDLHLMOW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)