CAS 56304-74-6 is the registry number for 2-Oxo-6-(2-pyridinyl)-1,2-dihydro-3-pyridinecarbonitrile. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-oxo-6-pyridin-2-yl-1H-pyridine-3-carbonitrile (CAS 56304-74-6) is a chemical compound with the molecular formula C11H7N3O and a molecular weight of 197.19 g/mol. IUPAC name: 2-oxo-6-pyridin-2-yl-1H-pyridine-3-carbonitrile. InChIKey: SYIROVGISVODAH-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-oxo-6-pyridin-2-yl-1H-pyridine-3-carbonitrile |
| InChIKey | SYIROVGISVODAH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C(=O)N2)C#N |
Computed by PubChem (NCBI)