Products 119570-59-1
CAS 119570-59-1 is the registry number for 10-(3-Dimethylamino-2-methylpropyl)phenothiazine-5-oxide Maleate. Offered by: TRC. Available pack sizes: 100mg.
(Z)-but-2-enedioic acid;N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine (CAS 119570-59-1) is a chemical compound with the molecular formula C22H26N2O5S and a molecular weight of 430.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine. InChIKey: NRPUQEVCMBSDIK-BTJKTKAUSA-N.
| Molecular formula | C22H26N2O5S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine |
| InChIKey | NRPUQEVCMBSDIK-BTJKTKAUSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31)CN(C)C.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)