Products 370094-12-5
CAS 370094-12-5 appears in our catalog under these names: Diltiazem Sulfoxide, Diltiazem Impurity 26, Diltiazem Sulfoxide, >95% (HPLC), Diltiazem Sulphoxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 25mg, 50mg, 4x25mg, 10mg.
[(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-1,4-dioxo-2,3-dihydro-1lambda4,5-benzothiazepin-3-yl] acetate (CAS 370094-12-5) is a chemical compound with the molecular formula C22H26N2O5S and a molecular weight of 430.5 g/mol. IUPAC name: [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-1,4-dioxo-2,3-dihydro-1lambda4,5-benzothiazepin-3-yl] acetate. InChIKey: ZHSTYLQHFVBOIN-SBCWPUQDSA-N.
| Molecular formula | C22H26N2O5S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-1,4-dioxo-2,3-dihydro-1lambda4,5-benzothiazepin-3-yl] acetate |
| InChIKey | ZHSTYLQHFVBOIN-SBCWPUQDSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](S(=O)C2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
Diltiazem Sulfoxide, Diltiazem, 1-oxide