CAS 142843-04-7 appears in our catalog under these names: Diltiazem N-Oxide, Diltiazem Impurity 10(N-Oxide), Diltiazem N-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-[(2S,3S)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N,N-dimethylethanamine oxide (CAS 142843-04-7) is a chemical compound with the molecular formula C22H26N2O5S and a molecular weight of 430.5 g/mol. IUPAC name: 2-[(2S,3S)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N,N-dimethylethanamine oxide. InChIKey: CJNKAQOSTBYXJM-RTWAWAEBSA-N.
| Molecular formula | C22H26N2O5S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 2-[(2S,3S)-3-acetyloxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-5-yl]-N,N-dimethylethanamine oxide |
| InChIKey | CJNKAQOSTBYXJM-RTWAWAEBSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)CC[N+](C)(C)[O-])C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)