Products 302333-18-2
CAS 302333-18-2 is the registry number for RH01617. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (2S)-2-[(4-butoxyphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate (CAS 302333-18-2) is a chemical compound with the molecular formula C22H26N2O5S and a molecular weight of 430.5 g/mol. IUPAC name: methyl (2S)-2-[(4-butoxyphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate. InChIKey: BRMKFAYWVMIHQZ-NRFANRHFSA-N.
| Molecular formula | C22H26N2O5S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | methyl (2S)-2-[(4-butoxyphenyl)sulfonylamino]-3-(1H-indol-3-yl)propanoate |
| InChIKey | BRMKFAYWVMIHQZ-NRFANRHFSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)OC |
Computed by PubChem (NCBI)