CAS 1195960-77-0 is the registry number for Propargyl β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
(2R,3R,4S,5R)-2-prop-2-ynoxyoxane-3,4,5-triol (CAS 1195960-77-0) is a chemical compound with the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. IUPAC name: (2R,3R,4S,5R)-2-prop-2-ynoxyoxane-3,4,5-triol. InChIKey: WJQCZNVPQVCGCQ-ULAWRXDQSA-N.
| Molecular formula | C8H12O5 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-prop-2-ynoxyoxane-3,4,5-triol |
| InChIKey | WJQCZNVPQVCGCQ-ULAWRXDQSA-N |
| SMILES | C#CCO[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)