CAS 1196145-07-9 appears in our catalog under these names: 3-(tert-Butoxycarbonylamino)-2,2-difluoropropanoic acid, 95%, N–Boc–3–amino–2,2–difluoropropionic Acid, N-Boc-3-amino-2,2-difluoropropionic acid, 3-((tert-Butoxycarbonyl)amino)-2,2-difluoropropanoic acid 97%, 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,2-difluoropropanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg, 10g.
2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1196145-07-9) is a chemical compound with the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. IUPAC name: 2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZGMUUJAHYZSWTF-UHFFFAOYSA-N.
| Molecular formula | C8H13F2NO4 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZGMUUJAHYZSWTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C(=O)O)(F)F |
Computed by PubChem (NCBI)