CAS 2349311-08-4 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-3,3-difluoropropanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2349311-08-4) is a chemical compound with the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. IUPAC name: (2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RBBANSRZYXHAHO-BYPYZUCNSA-N.
| Molecular formula | C8H13F2NO4 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | (2R)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RBBANSRZYXHAHO-BYPYZUCNSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(F)F)C(=O)O |
Computed by PubChem (NCBI)