CAS 1393529-90-2 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3,3-difluoropropanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1393529-90-2) is a chemical compound with the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. IUPAC name: 3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RBBANSRZYXHAHO-UHFFFAOYSA-N.
| Molecular formula | C8H13F2NO4 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RBBANSRZYXHAHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(F)F)C(=O)O |
Computed by PubChem (NCBI)