CAS 1807542-96-6 is the registry number for (3,3-Difluorocyclopentyl)methanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3,3-difluorocyclopentyl)methanamine;oxalic acid (CAS 1807542-96-6) is a chemical compound with the molecular formula C8H13F2NO4 and a molecular weight of 225.19 g/mol. IUPAC name: (3,3-difluorocyclopentyl)methanamine;oxalic acid. InChIKey: DZAXQRCDULYIKC-UHFFFAOYSA-N.
| Molecular formula | C8H13F2NO4 |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | (3,3-difluorocyclopentyl)methanamine;oxalic acid |
| InChIKey | DZAXQRCDULYIKC-UHFFFAOYSA-N |
| SMILES | C1CC(CC1CN)(F)F.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)