Products 1196145-79-5
CAS 1196145-79-5 is the registry number for 7-Chloro-2H-pyrano(2,3-b)pyridin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-chloro-2,3-dihydropyrano[2,3-b]pyridin-4-one (CAS 1196145-79-5) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 7-chloro-2,3-dihydropyrano[2,3-b]pyridin-4-one. InChIKey: BOPVAHLYFVGKNB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 7-chloro-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| InChIKey | BOPVAHLYFVGKNB-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=N2)Cl |
Computed by PubChem (NCBI)