CAS 1196151-49-1 is the registry number for p-Azidophenylglyoxal Monohydrate. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg, 50mg, 500mg, 1000mg.
2-(4-azidophenyl)-2-oxoacetaldehyde;hydrate (CAS 1196151-49-1) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(4-azidophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: CBYYPIYKJZCKGK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(4-azidophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | CBYYPIYKJZCKGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)N=[N+]=[N-].O |
Computed by PubChem (NCBI)