Products 1196153-16-8
CAS 1196153-16-8 is the registry number for 2-(Trifluoromethyl)-6,7-dihydropyrazolo(1,5-a)pyrazin-4(5H)-one, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1196153-16-8) is a chemical compound with the molecular formula C7H6F3N3O and a molecular weight of 205.14 g/mol. IUPAC name: 2-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: KTLKJEDERSICIL-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O |
|---|---|
| Molecular weight | 205.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | KTLKJEDERSICIL-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=N2)C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)