CAS 386715-32-8 appears in our catalog under these names: 6-(Trifluoromethyl)nicotinohydrazide, 95%, 6-(Trifluoromethyl)nicotinohydrazide, 98%, 98%, 6-(Trifluoromethyl)nicotinic acid hydrazide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
6-(trifluoromethyl)pyridine-3-carbohydrazide (CAS 386715-32-8) is a chemical compound with the molecular formula C7H6F3N3O and a molecular weight of 205.14 g/mol. IUPAC name: 6-(trifluoromethyl)pyridine-3-carbohydrazide. InChIKey: BZUUTXAGAJENNS-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O |
|---|---|
| Molecular weight | 205.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)pyridine-3-carbohydrazide |
| InChIKey | BZUUTXAGAJENNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)NN)C(F)(F)F |
Computed by PubChem (NCBI)