CAS 2094627-94-6 appears in our catalog under these names: 1-(Trifluoromethyl)-5H,6H,7H,8H-imidazo(1,5-a)pyrazin-8-one, 95%, 1-(Trifluoromethyl)-5H,6H,7H,8H-imidazo(1,5-a)pyrazin-8-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(trifluoromethyl)-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (CAS 2094627-94-6) is a chemical compound with the molecular formula C7H6F3N3O and a molecular weight of 205.14 g/mol. IUPAC name: 1-(trifluoromethyl)-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one. InChIKey: OTAWIKRORPHYRK-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O |
|---|---|
| Molecular weight | 205.14 g/mol |
| IUPAC name | 1-(trifluoromethyl)-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| InChIKey | OTAWIKRORPHYRK-UHFFFAOYSA-N |
| SMILES | C1CN2C=NC(=C2C(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)