Products 175204-84-9
CAS 175204-84-9 appears in our catalog under these names: 4-(Trifluoromethyl)pyridine-3-carboxylic acid hydrazide, 95%, 4-(Trifluoromethyl)nicotinohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-(trifluoromethyl)pyridine-3-carbohydrazide (CAS 175204-84-9) is a chemical compound with the molecular formula C7H6F3N3O and a molecular weight of 205.14 g/mol. IUPAC name: 4-(trifluoromethyl)pyridine-3-carbohydrazide. InChIKey: FWQRJTGWIXTZST-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O |
|---|---|
| Molecular weight | 205.14 g/mol |
| IUPAC name | 4-(trifluoromethyl)pyridine-3-carbohydrazide |
| InChIKey | FWQRJTGWIXTZST-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)C(=O)NN |
Computed by PubChem (NCBI)