Products 1196702-79-0
CAS 1196702-79-0 appears in our catalog under these names: 4-(Aminomethyl)-2-(trifluoromethyl)aniline hydrochloride, 95%, 4–(Aminomethyl)–2–(trifluoromethyl)aniline Hydrochloride, 4-(Aminomethyl)-2-(trifluoromethyl)aniline Hydrochloride, ≥95%, ≥95%, 4-(Aminomethyl)-2-(trifluoromethyl)aniline hydrochloride. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
4-(aminomethyl)-2-(trifluoromethyl)aniline;hydrochloride (CAS 1196702-79-0) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: 4-(aminomethyl)-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: WAAIJGJWHNVKKS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 4-(aminomethyl)-2-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | WAAIJGJWHNVKKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)