CAS 1951441-74-9 is the registry number for N-Methyl-1-(3-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-methyl-1-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride (CAS 1951441-74-9) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: N-methyl-1-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride. InChIKey: ITQNCJUNWYWSGU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | N-methyl-1-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | ITQNCJUNWYWSGU-UHFFFAOYSA-N |
| SMILES | CNCC1=C(C=CC=N1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)