CAS 1951440-08-6 appears in our catalog under these names: 1-(2-(Trifluoromethyl)pyridin-4-yl)ethanamine hydrochloride, 95%, 1–(2–(Trifluoromethyl)pyridin–4–yl)ethanamine hydrochloride, 1-(2-(Trifluoromethyl)pyridin-4-yl)ethanamine hydrochloride 95%, 1-(2-(TRIFLUOROMETHYL)PYRIDIN-4-YL)ETHANAMINE HCL, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride (CAS 1951440-08-6) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: 1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride. InChIKey: VYEISHWECZNEAK-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)-4-pyridinyl]ethanamine;hydrochloride |
| InChIKey | VYEISHWECZNEAK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)