Products 74195-71-4
CAS 74195-71-4 appears in our catalog under these names: (4-(Trifluoromethyl)benzyl)hydrazine hydrochloride, 95%, {[4-(TRIFLUOROMETHYL)PHENYL]METHYLHYDRAZINE HCL, 98%, (4-(Trifluoromethyl)benzyl)hydrazine hydrochloride, 98%, (4-(Trifluoromethyl)benzyl)hydrazine hydrochloride, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
[[4-(trifluoromethyl)phenyl]methylamino]azanium chloride (CAS 74195-71-4) is a chemical compound with the molecular formula C8H10ClF3N2 and a molecular weight of 226.62 g/mol. IUPAC name: [[4-(trifluoromethyl)phenyl]methylamino]azanium chloride. InChIKey: WWUDXEYZLIETJZ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF3N2 |
|---|---|
| Molecular weight | 226.62 g/mol |
| IUPAC name | [[4-(trifluoromethyl)phenyl]methylamino]azanium chloride |
| InChIKey | WWUDXEYZLIETJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN[NH3+])C(F)(F)F.[Cl-] |
Computed by PubChem (NCBI)