Products 119714-13-5
CAS 119714-13-5 appears in our catalog under these names: Tamsulosin Impurity P, Tamsulosin Impurity 7 , Tamsulosin Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide (CAS 119714-13-5) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide. InChIKey: IORITYIZDHJCGT-ZETCQYMHSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 5-[(2S)-2-aminopropyl]-2-methoxybenzenesulfonamide |
| InChIKey | IORITYIZDHJCGT-ZETCQYMHSA-N |
| SMILES | C[C@@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)N)N |
Computed by PubChem (NCBI)