CAS 1206969-35-8 is the registry number for 3,5-Dimethyl-4-((pyrrolidin-3-ylsulfonyl)methyl)isoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
3,5-dimethyl-4-(pyrrolidin-3-ylsulfonylmethyl)-1,2-oxazole (CAS 1206969-35-8) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 3,5-dimethyl-4-(pyrrolidin-3-ylsulfonylmethyl)-1,2-oxazole. InChIKey: KCJCRRZPKULGLU-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 3,5-dimethyl-4-(pyrrolidin-3-ylsulfonylmethyl)-1,2-oxazole |
| InChIKey | KCJCRRZPKULGLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CS(=O)(=O)C2CCNC2 |
Computed by PubChem (NCBI)