CAS 1263376-27-7 is the registry number for 2,3-Dihydro-1h-inden-2-ylhydrazine methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,3-dihydro-1H-inden-2-ylhydrazine;methanesulfonic acid (CAS 1263376-27-7) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 2,3-dihydro-1H-inden-2-ylhydrazine;methanesulfonic acid. InChIKey: COJCCRQRGPNWJI-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-2-ylhydrazine;methanesulfonic acid |
| InChIKey | COJCCRQRGPNWJI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1C(CC2=CC=CC=C21)NN |
Computed by PubChem (NCBI)