Products 1217850-77-5
CAS 1217850-77-5 appears in our catalog under these names: rac-Biotin-d4, rac Biotin-d4, >95% (HPLC), Biotin-d4, rel–Biotin–d4, rel-Biotin-d4, 98.04%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 0,5mg, 10mg, 1mg, 1 mg.
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid (CAS 1217850-77-5) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 248.34 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid. InChIKey: YBJHBAHKTGYVGT-CCSQOTJNSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 248.34 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid |
| InChIKey | YBJHBAHKTGYVGT-CCSQOTJNSA-N |
| SMILES | [2H]C([2H])(C[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2)C([2H])([2H])CC(=O)O |
Computed by PubChem (NCBI)