Products 1197193-19-3
CAS 1197193-19-3 appears in our catalog under these names: 4–(Methylsulfonyl)–3–morpholinobenzoic Acid, 4-(Methylsulfonyl)-3-morpholinobenzoic acid, 95%, 4-(Methylsulfonyl)-3-morpholinobenzoic acid, >95%, 4-(Methylsulfonyl)-3-morpholinobenzoic acid, >95%, >95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
4-methylsulfonyl-3-morpholin-4-ylbenzoic acid (CAS 1197193-19-3) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: 4-methylsulfonyl-3-morpholin-4-ylbenzoic acid. InChIKey: KGBOPGFDGBEMSK-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 4-methylsulfonyl-3-morpholin-4-ylbenzoic acid |
| InChIKey | KGBOPGFDGBEMSK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)C(=O)O)N2CCOCC2 |
Computed by PubChem (NCBI)