Products 91642-62-5

CAS 91642-62-5 is the registry number for 2-Hydroxy-5-(piperidin-1-ylsulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-hydroxy-5-piperidin-1-ylsulfonylbenzoic acid (CAS 91642-62-5) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: 2-hydroxy-5-piperidin-1-ylsulfonylbenzoic acid. InChIKey: IFPKNTKNJVPVPX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO5S
Molecular weight285.32 g/mol
IUPAC name2-hydroxy-5-piperidin-1-ylsulfonylbenzoic acid
InChIKeyIFPKNTKNJVPVPX-UHFFFAOYSA-N
SMILESC1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)