Products 300383-08-8

CAS 300383-08-8 is the registry number for 4-Methyl-3-(morpholine-4-sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methyl-3-morpholin-4-ylsulfonylbenzoic acid (CAS 300383-08-8) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: 4-methyl-3-morpholin-4-ylsulfonylbenzoic acid. InChIKey: XWGOGAHEPWTCCH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO5S
Molecular weight285.32 g/mol
IUPAC name4-methyl-3-morpholin-4-ylsulfonylbenzoic acid
InChIKeyXWGOGAHEPWTCCH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)N2CCOCC2

Computed by PubChem (NCBI)