Products 1274791-41-1
CAS 1274791-41-1 appears in our catalog under these names: 2-Acetamido-2-(4-methanesulfonylphenyl)propanoic acid, 95%, 2-Acetamido-2-(4-methanesulfonylphenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-acetamido-2-(4-methylsulfonylphenyl)propanoic acid (CAS 1274791-41-1) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: 2-acetamido-2-(4-methylsulfonylphenyl)propanoic acid. InChIKey: XHOXWQZANFLTCD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 2-acetamido-2-(4-methylsulfonylphenyl)propanoic acid |
| InChIKey | XHOXWQZANFLTCD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(C1=CC=C(C=C1)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)