CAS 872108-15-1 is the registry number for 6-(Morpholine-4-sulfonyl)-1,2,3,4-tetrahydroquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine (CAS 872108-15-1) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine. InChIKey: KAMNGGDTVUTTBV-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine |
| InChIKey | KAMNGGDTVUTTBV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)S(=O)(=O)N3CCOCC3)NC1 |
Computed by PubChem (NCBI)