CAS 923183-91-9 is the registry number for 1-methyl-N-(4-sulfamoylphenyl)cyclopentane-1-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
1-methyl-N-(4-sulfamoylphenyl)cyclopentane-1-carboxamide (CAS 923183-91-9) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: 1-methyl-N-(4-sulfamoylphenyl)cyclopentane-1-carboxamide. InChIKey: BCBOKCBFTLJDTB-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 1-methyl-N-(4-sulfamoylphenyl)cyclopentane-1-carboxamide |
| InChIKey | BCBOKCBFTLJDTB-UHFFFAOYSA-N |
| SMILES | CC1(CCCC1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)