CAS 1197232-50-0 appears in our catalog under these names: 3'-Fluoro-(1,1'-biphenyl)-4-amine hydrochloride, 97%, 3'-Fluorobiphenyl-4-ylamine hydrochloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
4-(3-fluorophenyl)aniline;hydrochloride (CAS 1197232-50-0) is a chemical compound with the molecular formula C12H11ClFN and a molecular weight of 223.67 g/mol. IUPAC name: 4-(3-fluorophenyl)aniline;hydrochloride. InChIKey: IFDYESMPLQOASG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFN |
|---|---|
| Molecular weight | 223.67 g/mol |
| IUPAC name | 4-(3-fluorophenyl)aniline;hydrochloride |
| InChIKey | IFDYESMPLQOASG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)