CAS 1456074-62-6 appears in our catalog under these names: 1-(4-Chloro-2-fluorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(4-Chloro-2-fluorophenyl)-2,5-dimethyl-1H-pyrrole, 98%, 1-(4-Chloro-2-fluorophenyl)-2,5-dimethyl-1H-pyrrole, ≥95%, ≥95%, 1-(4-Chloro-2-fluorophenyl)-2,5-dimethyl-1H-pyrrole, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1-(4-chloro-2-fluorophenyl)-2,5-dimethylpyrrole (CAS 1456074-62-6) is a chemical compound with the molecular formula C12H11ClFN and a molecular weight of 223.67 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)-2,5-dimethylpyrrole. InChIKey: JJYMLZMLMZNAAN-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFN |
|---|---|
| Molecular weight | 223.67 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)-2,5-dimethylpyrrole |
| InChIKey | JJYMLZMLMZNAAN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=C(C=C2)Cl)F)C |
Computed by PubChem (NCBI)