Products 1692-00-8
CAS 1692-00-8 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(3-Chloro-4-fluorophenyl)-2,5-dimethyl-1H-pyrrole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrole (CAS 1692-00-8) is a chemical compound with the molecular formula C12H11ClFN and a molecular weight of 223.67 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrole. InChIKey: FKKIJZCPWXAWPE-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFN |
|---|---|
| Molecular weight | 223.67 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrole |
| InChIKey | FKKIJZCPWXAWPE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=C(C=C2)F)Cl)C |
Computed by PubChem (NCBI)