Products 2167567-74-8
CAS 2167567-74-8 is the registry number for 1-(4-Chloro-3-fluorophenyl)cyclopentanecarbonitrile, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-chloro-3-fluorophenyl)cyclopentane-1-carbonitrile (CAS 2167567-74-8) is a chemical compound with the molecular formula C12H11ClFN and a molecular weight of 223.67 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)cyclopentane-1-carbonitrile. InChIKey: UTACANTTXUWIGD-UHFFFAOYSA-N.
| Molecular formula | C12H11ClFN |
|---|---|
| Molecular weight | 223.67 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)cyclopentane-1-carbonitrile |
| InChIKey | UTACANTTXUWIGD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)