CAS 3838-42-4 is the registry number for 3'-(Trifluoromethyl)-(1,1'-biphenyl)-4-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-[3-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 3838-42-4) is a chemical compound with the molecular formula C13H11ClF3N and a molecular weight of 273.68 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: VLZGAUXMIKTIRR-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | VLZGAUXMIKTIRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)