Products 1197834-68-6
CAS 1197834-68-6 is the registry number for 4-(2-Propanamido-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[2-(propanoylamino)-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxamide (CAS 1197834-68-6) is a chemical compound with the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. IUPAC name: 4-[2-(propanoylamino)-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxamide. InChIKey: KQXIMJZPKUSHGM-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2S |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | 4-[2-(propanoylamino)-1,3-thiazol-4-yl]-1H-pyrrole-2-carboxamide |
| InChIKey | KQXIMJZPKUSHGM-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=NC(=CS1)C2=CNC(=C2)C(=O)N |
Computed by PubChem (NCBI)