Products 119802-68-5
CAS 119802-68-5 is the registry number for Bupropion impurity 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol (CAS 119802-68-5) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol. InChIKey: NDPTTXIBLSWNSF-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol |
| InChIKey | NDPTTXIBLSWNSF-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC(=CC=C1)Cl)O)NC(C)(C)C |
Computed by PubChem (NCBI)